About 6-anthracen-9-yl-2-chlorocyclohexa-1,5-dien-3-yn-1-amine
6-anthracen-9-yl-2-chlorocyclohexa-1,5-dien-3-yn-1-amine (PubChem CID 167281866) has the molecular formula C20H12ClN
and a molecular weight of 301.78 g/mol. Its IUPAC name is 6-anthracen-9-yl-2-chlorocyclohexa-1,5-dien-3-yn-1-amine.
Molecular Properties
| Compound Name | 6-anthracen-9-yl-2-chlorocyclohexa-1,5-dien-3-yn-1-amine |
| PubChem CID | 167281866 |
| Molecular Formula | C20H12ClN |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 6-anthracen-9-yl-2-chlorocyclohexa-1,5-dien-3-yn-1-amine |
| SMILES | Nc1c(Cl)c#ccc1-c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C20H12ClN/c21-18-11-5-10-17(20(18)22)19-15-8-3-1-6-13(15)12-14-7-2-4-9-16(14)19/h1-4,6-10,12H,22H2 |
| InChIKey | YNEOEOCUXDNQAJ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 6-anthracen-9-yl-2-chlorocyclohexa-1,5-dien-3-yn-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-anthracen-9-yl-2-chlorocyclohexa-1,5-dien-3-yn-1-amine?
The IUPAC name of 6-anthracen-9-yl-2-chlorocyclohexa-1,5-dien-3-yn-1-amine (CID 167281866) is 6-anthracen-9-yl-2-chlorocyclohexa-1,5-dien-3-yn-1-amine.
What is the SMILES notation for 6-anthracen-9-yl-2-chlorocyclohexa-1,5-dien-3-yn-1-amine?
The canonical SMILES for 6-anthracen-9-yl-2-chlorocyclohexa-1,5-dien-3-yn-1-amine is Nc1c(Cl)c#ccc1-c1c2ccccc2cc2ccccc12.
What is the InChIKey of 6-anthracen-9-yl-2-chlorocyclohexa-1,5-dien-3-yn-1-amine?
The InChIKey is YNEOEOCUXDNQAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12ClN/c21-18-11-5-10-17(20(18)22)19-15-8-3-1-6-13(15)12-14-7-2-4-9-16(14)19/h1-4,6-10,12H,22H2.
What are the key properties of 6-anthracen-9-yl-2-chlorocyclohexa-1,5-dien-3-yn-1-amine?
6-anthracen-9-yl-2-chlorocyclohexa-1,5-dien-3-yn-1-amine has a molecular weight of 301.78 g/mol, XLogP of 5.50, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-anthracen-9-yl-2-chlorocyclohexa-1,5-dien-3-yn-1-amine is sourced from PubChem (CID 167281866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).