C27H31FN4O2S — CID 167282063
[4-[(E)-[2-[[4-(1-methyl-4a,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazin-4-yl)phenyl]methylamino]-2-oxoethoxy]iminomethyl]phenyl] thiohypofluorite (PubChem CID 167282063) has the molecular formula C27H31FN4O2S and a molecular weight of 494.64 g/mol. Its IUPAC name is [4-[(E)-[2-[[4-(1-methyl-4a,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazin-4-yl)phenyl]methylamino]-2-oxoethoxy]iminomethyl]phenyl] thiohypofluorite.
| Compound Name | [4-[(E)-[2-[[4-(1-methyl-4a,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazin-4-yl)phenyl]methylamino]-2-oxoethoxy]iminomethyl]phenyl] thiohypofluorite |
|---|---|
| PubChem CID | 167282063 |
| Molecular Formula | C27H31FN4O2S |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | [4-[(E)-[2-[[4-(1-methyl-4a,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazin-4-yl)phenyl]methylamino]-2-oxoethoxy]iminomethyl]phenyl] thiohypofluorite |
| SMILES | CC1=NN=C(c2ccc(CNC(=O)CO/N=C/c3ccc(SF)cc3)cc2)C2CCCCCCC12 |
| InChI | InChI=1S/C27H31FN4O2S/c1-19-24-6-4-2-3-5-7-25(24)27(32-31-19)22-12-8-20(9-13-22)16-29-26(33)18-34-30-17-21-10-14-23(35-28)15-11-21/h8-15,17,24-25H,2-7,16,18H2,1H3,(H,29,33)/b30-17+ |
| InChIKey | YIGGTORVLWHROO-OCSSWDANSA-N |
| XLogP | 6.10 |
| TPSA | 75.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|