C13H28N4 — CID 167282500
N-methyl-N'-[1-[(1-propan-2-ylazetidin-3-yl)methyl]azetidin-3-yl]ethane-1,2-diamine (PubChem CID 167282500) has the molecular formula C13H28N4 and a molecular weight of 240.39 g/mol. Its IUPAC name is N-methyl-N'-[1-[(1-propan-2-ylazetidin-3-yl)methyl]azetidin-3-yl]ethane-1,2-diamine.
| Compound Name | N-methyl-N'-[1-[(1-propan-2-ylazetidin-3-yl)methyl]azetidin-3-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 167282500 |
| Molecular Formula | C13H28N4 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.23 |
| IUPAC Name | N-methyl-N'-[1-[(1-propan-2-ylazetidin-3-yl)methyl]azetidin-3-yl]ethane-1,2-diamine |
| SMILES | CNCCNC1CN(CC2CN(C(C)C)C2)C1 |
| InChI | InChI=1S/C13H28N4/c1-11(2)17-7-12(8-17)6-16-9-13(10-16)15-5-4-14-3/h11-15H,4-10H2,1-3H3 |
| InChIKey | CFBKWKYOYUTLRI-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|