C25H30N8O2 — CID 167282981
7-(4-hydroxyphenyl)-N,N-dimethyl-2-[[(1Z,3E)-1-(methylideneamino)-4-piperazin-1-ylpenta-1,3-dienyl]amino]pyrrolo[2,1-f][1,2,4]triazine-6-carboxamide (PubChem CID 167282981) has the molecular formula C25H30N8O2 and a molecular weight of 474.57 g/mol. Its IUPAC name is 7-(4-hydroxyphenyl)-N,N-dimethyl-2-[[(1Z,3E)-1-(methylideneamino)-4-piperazin-1-ylpenta-1,3-dienyl]amino]pyrrolo[2,1-f][1,2,4]triazine-6-carboxamide.
| Compound Name | 7-(4-hydroxyphenyl)-N,N-dimethyl-2-[[(1Z,3E)-1-(methylideneamino)-4-piperazin-1-ylpenta-1,3-dienyl]amino]pyrrolo[2,1-f][1,2,4]triazine-6-carboxamide |
|---|---|
| PubChem CID | 167282981 |
| Molecular Formula | C25H30N8O2 |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 7-(4-hydroxyphenyl)-N,N-dimethyl-2-[[(1Z,3E)-1-(methylideneamino)-4-piperazin-1-ylpenta-1,3-dienyl]amino]pyrrolo[2,1-f][1,2,4]triazine-6-carboxamide |
| SMILES | C=N/C(=C\C=C(/C)N1CCNCC1)Nc1ncc2cc(C(=O)N(C)C)c(-c3ccc(O)cc3)n2n1 |
| InChI | InChI=1S/C25H30N8O2/c1-17(32-13-11-27-12-14-32)5-10-22(26-2)29-25-28-16-19-15-21(24(35)31(3)4)23(33(19)30-25)18-6-8-20(34)9-7-18/h5-10,15-16,27,34H,2,11-14H2,1,3-4H3,(H,29,30)/b17-5+,22-10+ |
| InChIKey | PYDWNQBBEDEZTN-LTUQUDDFSA-N |
| XLogP | 2.57 |
| TPSA | 110.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|