C20H28O4 — CID 167283363
(4S,5R,9S,10S,13S)-14-formyl-13-hydroxy-5,9-dimethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-ene-5-carboxylic acid (PubChem CID 167283363) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (4S,5R,9S,10S,13S)-14-formyl-13-hydroxy-5,9-dimethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-ene-5-carboxylic acid.
| Compound Name | (4S,5R,9S,10S,13S)-14-formyl-13-hydroxy-5,9-dimethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-ene-5-carboxylic acid |
|---|---|
| PubChem CID | 167283363 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (4S,5R,9S,10S,13S)-14-formyl-13-hydroxy-5,9-dimethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-ene-5-carboxylic acid |
| SMILES | C[C@@]12CCC[C@@](C)(C(=O)O)[C@H]1CCC13C=C(C=O)[C@](O)(CC[C@H]12)C3 |
| InChI | InChI=1S/C20H28O4/c1-17-6-3-7-18(2,16(22)23)14(17)4-8-19-10-13(11-21)20(24,12-19)9-5-15(17)19/h10-11,14-15,24H,3-9,12H2,1-2H3,(H,22,23)/t14-,15-,17+,18+,19?,20-/m0/s1 |
| InChIKey | SGNGVXCFRKDPDR-HXEVHVHFSA-N |
| XLogP | 3.33 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|