C20H39FO3 — CID 167283417
3-fluoro-2-(2-methylpentan-2-yl)-5-(2-methylpentan-2-yloxymethyl)-4-propan-2-yloxyoxolane (PubChem CID 167283417) has the molecular formula C20H39FO3 and a molecular weight of 346.53 g/mol. Its IUPAC name is 3-fluoro-2-(2-methylpentan-2-yl)-5-(2-methylpentan-2-yloxymethyl)-4-propan-2-yloxyoxolane.
| Compound Name | 3-fluoro-2-(2-methylpentan-2-yl)-5-(2-methylpentan-2-yloxymethyl)-4-propan-2-yloxyoxolane |
|---|---|
| PubChem CID | 167283417 |
| Molecular Formula | C20H39FO3 |
| Molecular Weight | 346.53 g/mol |
| Exact Mass | 346.29 |
| IUPAC Name | 3-fluoro-2-(2-methylpentan-2-yl)-5-(2-methylpentan-2-yloxymethyl)-4-propan-2-yloxyoxolane |
| SMILES | CCCC(C)(C)OCC1OC(C(C)(C)CCC)C(F)C1OC(C)C |
| InChI | InChI=1S/C20H39FO3/c1-9-11-19(5,6)18-16(21)17(23-14(3)4)15(24-18)13-22-20(7,8)12-10-2/h14-18H,9-13H2,1-8H3 |
| InChIKey | KJTUHYLHIQIELE-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.53 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |