C20H29FN5O4P — CID 167283527
(2S)-2-azido-N-[4-[[(cyclopropylmethylamino)-[(E)-5-hydroxy-4-methylpent-3-enyl]phosphoryl]oxymethyl]-3-fluorophenyl]propanamide (PubChem CID 167283527) has the molecular formula C20H29FN5O4P and a molecular weight of 453.46 g/mol. Its IUPAC name is (2S)-2-azido-N-[4-[[(cyclopropylmethylamino)-[(E)-5-hydroxy-4-methylpent-3-enyl]phosphoryl]oxymethyl]-3-fluorophenyl]propanamide.
| Compound Name | (2S)-2-azido-N-[4-[[(cyclopropylmethylamino)-[(E)-5-hydroxy-4-methylpent-3-enyl]phosphoryl]oxymethyl]-3-fluorophenyl]propanamide |
|---|---|
| PubChem CID | 167283527 |
| Molecular Formula | C20H29FN5O4P |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | (2S)-2-azido-N-[4-[[(cyclopropylmethylamino)-[(E)-5-hydroxy-4-methylpent-3-enyl]phosphoryl]oxymethyl]-3-fluorophenyl]propanamide |
| SMILES | C/C(=C\CCP(=O)(NCC1CC1)OCc1ccc(NC(=O)[C@H](C)N=[N+]=[N-])cc1F)CO |
| InChI | InChI=1S/C20H29FN5O4P/c1-14(12-27)4-3-9-31(29,23-11-16-5-6-16)30-13-17-7-8-18(10-19(17)21)24-20(28)15(2)25-26-22/h4,7-8,10,15-16,27H,3,5-6,9,11-13H2,1-2H3,(H,23,29)(H,24,28)/b14-4+/t15-,31?/m0/s1 |
| InChIKey | RXYKFWBFCWXZRE-WTKHDCACSA-N |
| XLogP | 4.50 |
| TPSA | 136.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|