About CID 167283553
CID 167283553 (PubChem CID 167283553) has the molecular formula C14H13BrF2N2O2
and a molecular weight of 359.17 g/mol.
Molecular Properties
| Compound Name | CID 167283553 |
| PubChem CID | 167283553 |
| Molecular Formula | C14H13BrF2N2O2 |
| Molecular Weight | 359.17 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | — |
| SMILES | O=C1NC2(CCC3(CC2)CC3(F)F)n2c1ccc(Br)c2=O |
| InChI | InChI=1S/C14H13BrF2N2O2/c15-8-1-2-9-10(20)18-13(19(9)11(8)21)5-3-12(4-6-13)7-14(12,16)17/h1-2H,3-7H2,(H,18,20) |
| InChIKey | XDGAJSLWRCQAGU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.17 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 167283553 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167283553?
The IUPAC name of CID 167283553 (CID 167283553) is not available.
What is the SMILES notation for CID 167283553?
The canonical SMILES for CID 167283553 is O=C1NC2(CCC3(CC2)CC3(F)F)n2c1ccc(Br)c2=O.
What is the InChIKey of CID 167283553?
The InChIKey is XDGAJSLWRCQAGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BrF2N2O2/c15-8-1-2-9-10(20)18-13(19(9)11(8)21)5-3-12(4-6-13)7-14(12,16)17/h1-2H,3-7H2,(H,18,20).
What are the key properties of CID 167283553?
CID 167283553 has a molecular weight of 359.17 g/mol, XLogP of 2.61, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167283553 is sourced from PubChem (CID 167283553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).