About 4-ethenyl-4-ethyl-1,2-dimethylpiperidine
4-ethenyl-4-ethyl-1,2-dimethylpiperidine (PubChem CID 167284042) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is 4-ethenyl-4-ethyl-1,2-dimethylpiperidine.
Molecular Properties
| Compound Name | 4-ethenyl-4-ethyl-1,2-dimethylpiperidine |
| PubChem CID | 167284042 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 4-ethenyl-4-ethyl-1,2-dimethylpiperidine |
| SMILES | C=CC1(CC)CCN(C)C(C)C1 |
| InChI | InChI=1S/C11H21N/c1-5-11(6-2)7-8-12(4)10(3)9-11/h5,10H,1,6-9H2,2-4H3 |
| InChIKey | RWSSLIMAKZOFNN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenyl-4-ethyl-1,2-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-4-ethyl-1,2-dimethylpiperidine?
The IUPAC name of 4-ethenyl-4-ethyl-1,2-dimethylpiperidine (CID 167284042) is 4-ethenyl-4-ethyl-1,2-dimethylpiperidine.
What is the SMILES notation for 4-ethenyl-4-ethyl-1,2-dimethylpiperidine?
The canonical SMILES for 4-ethenyl-4-ethyl-1,2-dimethylpiperidine is C=CC1(CC)CCN(C)C(C)C1.
What is the InChIKey of 4-ethenyl-4-ethyl-1,2-dimethylpiperidine?
The InChIKey is RWSSLIMAKZOFNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N/c1-5-11(6-2)7-8-12(4)10(3)9-11/h5,10H,1,6-9H2,2-4H3.
What are the key properties of 4-ethenyl-4-ethyl-1,2-dimethylpiperidine?
4-ethenyl-4-ethyl-1,2-dimethylpiperidine has a molecular weight of 167.30 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-4-ethyl-1,2-dimethylpiperidine is sourced from PubChem (CID 167284042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).