About 4-(5-ethyl-7-fluorocyclohepta-1,4,6-trien-1-yl)morpholine
4-(5-ethyl-7-fluorocyclohepta-1,4,6-trien-1-yl)morpholine (PubChem CID 167284429) has the molecular formula C13H18FNO
and a molecular weight of 223.29 g/mol. Its IUPAC name is 4-(5-ethyl-7-fluorocyclohepta-1,4,6-trien-1-yl)morpholine.
Molecular Properties
| Compound Name | 4-(5-ethyl-7-fluorocyclohepta-1,4,6-trien-1-yl)morpholine |
| PubChem CID | 167284429 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 4-(5-ethyl-7-fluorocyclohepta-1,4,6-trien-1-yl)morpholine |
| SMILES | CCC1=CCC=C(N2CCOCC2)C(F)=C1 |
| InChI | InChI=1S/C13H18FNO/c1-2-11-4-3-5-13(12(14)10-11)15-6-8-16-9-7-15/h4-5,10H,2-3,6-9H2,1H3 |
| InChIKey | XZZBCSWKGFHJBB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(5-ethyl-7-fluorocyclohepta-1,4,6-trien-1-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-ethyl-7-fluorocyclohepta-1,4,6-trien-1-yl)morpholine?
The IUPAC name of 4-(5-ethyl-7-fluorocyclohepta-1,4,6-trien-1-yl)morpholine (CID 167284429) is 4-(5-ethyl-7-fluorocyclohepta-1,4,6-trien-1-yl)morpholine.
What is the SMILES notation for 4-(5-ethyl-7-fluorocyclohepta-1,4,6-trien-1-yl)morpholine?
The canonical SMILES for 4-(5-ethyl-7-fluorocyclohepta-1,4,6-trien-1-yl)morpholine is CCC1=CCC=C(N2CCOCC2)C(F)=C1.
What is the InChIKey of 4-(5-ethyl-7-fluorocyclohepta-1,4,6-trien-1-yl)morpholine?
The InChIKey is XZZBCSWKGFHJBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18FNO/c1-2-11-4-3-5-13(12(14)10-11)15-6-8-16-9-7-15/h4-5,10H,2-3,6-9H2,1H3.
What are the key properties of 4-(5-ethyl-7-fluorocyclohepta-1,4,6-trien-1-yl)morpholine?
4-(5-ethyl-7-fluorocyclohepta-1,4,6-trien-1-yl)morpholine has a molecular weight of 223.29 g/mol, XLogP of 2.80, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-ethyl-7-fluorocyclohepta-1,4,6-trien-1-yl)morpholine is sourced from PubChem (CID 167284429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).