C15H20FN3OS — CID 167284951
(5S,7S)-2-tert-butylsulfinyl-5-cyclohexa-2,4-dien-1-yl-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole (PubChem CID 167284951) has the molecular formula C15H20FN3OS and a molecular weight of 309.41 g/mol. Its IUPAC name is (5S,7S)-2-tert-butylsulfinyl-5-cyclohexa-2,4-dien-1-yl-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole.
| Compound Name | (5S,7S)-2-tert-butylsulfinyl-5-cyclohexa-2,4-dien-1-yl-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 167284951 |
| Molecular Formula | C15H20FN3OS |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | (5S,7S)-2-tert-butylsulfinyl-5-cyclohexa-2,4-dien-1-yl-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
| SMILES | CC(C)(C)S(=O)c1nc2n(n1)[C@H](C1C=CC=CC1)C[C@@H]2F |
| InChI | InChI=1S/C15H20FN3OS/c1-15(2,3)21(20)14-17-13-11(16)9-12(19(13)18-14)10-7-5-4-6-8-10/h4-7,10-12H,8-9H2,1-3H3/t10?,11-,12-,21?/m0/s1 |
| InChIKey | SFPAPSQRLLYQFX-QKAZJRGOSA-N |
| XLogP | 3.27 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |