C55H34F2N4 — CID 167285639
10-[4,6-bis(4-fluorophenyl)-1,3,5-triazin-2-yl]-N,N-bis(4-phenylphenyl)fluoranthen-7-amine (PubChem CID 167285639) has the molecular formula C55H34F2N4 and a molecular weight of 788.90 g/mol. Its IUPAC name is 10-[4,6-bis(4-fluorophenyl)-1,3,5-triazin-2-yl]-N,N-bis(4-phenylphenyl)fluoranthen-7-amine.
| Compound Name | 10-[4,6-bis(4-fluorophenyl)-1,3,5-triazin-2-yl]-N,N-bis(4-phenylphenyl)fluoranthen-7-amine |
|---|---|
| PubChem CID | 167285639 |
| Molecular Formula | C55H34F2N4 |
| Molecular Weight | 788.90 g/mol |
| Exact Mass | 788.28 |
| IUPAC Name | 10-[4,6-bis(4-fluorophenyl)-1,3,5-triazin-2-yl]-N,N-bis(4-phenylphenyl)fluoranthen-7-amine |
| SMILES | Fc1ccc(-c2nc(-c3ccc(F)cc3)nc(-c3ccc(N(c4ccc(-c5ccccc5)cc4)c4ccc(-c5ccccc5)cc4)c4c3-c3cccc5cccc-4c35)n2)cc1 |
| InChI | InChI=1S/C55H34F2N4/c56-42-25-17-40(18-26-42)53-58-54(41-19-27-43(57)28-20-41)60-55(59-53)48-33-34-49(52-47-16-8-14-39-13-7-15-46(50(39)47)51(48)52)61(44-29-21-37(22-30-44)35-9-3-1-4-10-35)45-31-23-38(24-32-45)36-11-5-2-6-12-36/h1-34H |
| InChIKey | RSBQJMDURVWKEQ-UHFFFAOYSA-N |
| XLogP | 14.76 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.90 |
| LogP ≤ 5 | 14.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |