About (E)-3-buta-1,3-dien-2-ylsulfanyl-N-ethylbut-2-en-1-imine
(E)-3-buta-1,3-dien-2-ylsulfanyl-N-ethylbut-2-en-1-imine (PubChem CID 167285758) has the molecular formula C10H15NS
and a molecular weight of 181.30 g/mol. Its IUPAC name is (E)-3-buta-1,3-dien-2-ylsulfanyl-N-ethylbut-2-en-1-imine.
Molecular Properties
| Compound Name | (E)-3-buta-1,3-dien-2-ylsulfanyl-N-ethylbut-2-en-1-imine |
| PubChem CID | 167285758 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | (E)-3-buta-1,3-dien-2-ylsulfanyl-N-ethylbut-2-en-1-imine |
| SMILES | C=CC(=C)S/C(C)=C/C=N/CC |
| InChI | InChI=1S/C10H15NS/c1-5-9(3)12-10(4)7-8-11-6-2/h5,7-8H,1,3,6H2,2,4H3/b10-7+,11-8+ |
| InChIKey | YDNHLXLNKAFWLN-AMMQDNIMSA-N |
| XLogP | 3.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-buta-1,3-dien-2-ylsulfanyl-N-ethylbut-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-buta-1,3-dien-2-ylsulfanyl-N-ethylbut-2-en-1-imine?
The IUPAC name of (E)-3-buta-1,3-dien-2-ylsulfanyl-N-ethylbut-2-en-1-imine (CID 167285758) is (E)-3-buta-1,3-dien-2-ylsulfanyl-N-ethylbut-2-en-1-imine.
What is the SMILES notation for (E)-3-buta-1,3-dien-2-ylsulfanyl-N-ethylbut-2-en-1-imine?
The canonical SMILES for (E)-3-buta-1,3-dien-2-ylsulfanyl-N-ethylbut-2-en-1-imine is C=CC(=C)S/C(C)=C/C=N/CC.
What is the InChIKey of (E)-3-buta-1,3-dien-2-ylsulfanyl-N-ethylbut-2-en-1-imine?
The InChIKey is YDNHLXLNKAFWLN-AMMQDNIMSA-N. The full InChI is InChI=1S/C10H15NS/c1-5-9(3)12-10(4)7-8-11-6-2/h5,7-8H,1,3,6H2,2,4H3/b10-7+,11-8+.
What are the key properties of (E)-3-buta-1,3-dien-2-ylsulfanyl-N-ethylbut-2-en-1-imine?
(E)-3-buta-1,3-dien-2-ylsulfanyl-N-ethylbut-2-en-1-imine has a molecular weight of 181.30 g/mol, XLogP of 3.41, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-buta-1,3-dien-2-ylsulfanyl-N-ethylbut-2-en-1-imine is sourced from PubChem (CID 167285758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).