C27H27N2O9P — CID 16728608
1-[(2R,5S)-5-[[8-(2,2-dimethyl-4H-1,3-benzodioxin-8-yl)-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl]oxymethyl]-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 16728608) has the molecular formula C27H27N2O9P and a molecular weight of 554.49 g/mol. Its IUPAC name is 1-[(2R,5S)-5-[[8-(2,2-dimethyl-4H-1,3-benzodioxin-8-yl)-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl]oxymethyl]-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5S)-5-[[8-(2,2-dimethyl-4H-1,3-benzodioxin-8-yl)-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl]oxymethyl]-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 16728608 |
| Molecular Formula | C27H27N2O9P |
| Molecular Weight | 554.49 g/mol |
| Exact Mass | 554.15 |
| IUPAC Name | 1-[(2R,5S)-5-[[8-(2,2-dimethyl-4H-1,3-benzodioxin-8-yl)-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl]oxymethyl]-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C=C[C@@H](COP3(=O)OCc4cccc(-c5cccc6c5OC(C)(C)OC6)c4O3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C27H27N2O9P/c1-16-12-29(26(31)28-25(16)30)22-11-10-19(36-22)15-35-39(32)34-14-18-7-5-9-21(24(18)38-39)20-8-4-6-17-13-33-27(2,3)37-23(17)20/h4-12,19,22H,13-15H2,1-3H3,(H,28,30,31)/t19-,22+,39?/m0/s1 |
| InChIKey | CCBOYGOTQIYLJA-CATCILLUSA-N |
| XLogP | 4.34 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|