C15H19ClN2O3 — CID 167286673
ethyl 1-(3-chloro-1-methoxy-6,7-dihydro-5H-cyclopenta[c]pyridin-7-yl)azetidine-3-carboxylate (PubChem CID 167286673) has the molecular formula C15H19ClN2O3 and a molecular weight of 310.78 g/mol. Its IUPAC name is ethyl 1-(3-chloro-1-methoxy-6,7-dihydro-5H-cyclopenta[c]pyridin-7-yl)azetidine-3-carboxylate.
| Compound Name | ethyl 1-(3-chloro-1-methoxy-6,7-dihydro-5H-cyclopenta[c]pyridin-7-yl)azetidine-3-carboxylate |
|---|---|
| PubChem CID | 167286673 |
| Molecular Formula | C15H19ClN2O3 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | ethyl 1-(3-chloro-1-methoxy-6,7-dihydro-5H-cyclopenta[c]pyridin-7-yl)azetidine-3-carboxylate |
| SMILES | CCOC(=O)C1CN(C2CCc3cc(Cl)nc(OC)c32)C1 |
| InChI | InChI=1S/C15H19ClN2O3/c1-3-21-15(19)10-7-18(8-10)11-5-4-9-6-12(16)17-14(20-2)13(9)11/h6,10-11H,3-5,7-8H2,1-2H3 |
| InChIKey | WESRLABUUPTCQU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|