About 6-cyclopentyl-6-[2-(1,3-thiazol-2-yl)ethyl]oxane-2,4-dione
6-cyclopentyl-6-[2-(1,3-thiazol-2-yl)ethyl]oxane-2,4-dione (PubChem CID 16728680) has the molecular formula C15H19NO3S
and a molecular weight of 293.39 g/mol. Its IUPAC name is 6-cyclopentyl-6-[2-(1,3-thiazol-2-yl)ethyl]oxane-2,4-dione.
Molecular Properties
| Compound Name | 6-cyclopentyl-6-[2-(1,3-thiazol-2-yl)ethyl]oxane-2,4-dione |
| PubChem CID | 16728680 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 6-cyclopentyl-6-[2-(1,3-thiazol-2-yl)ethyl]oxane-2,4-dione |
| SMILES | O=C1CC(=O)OC(CCc2nccs2)(C2CCCC2)C1 |
| InChI | InChI=1S/C15H19NO3S/c17-12-9-14(18)19-15(10-12,11-3-1-2-4-11)6-5-13-16-7-8-20-13/h7-8,11H,1-6,9-10H2 |
| InChIKey | VMVNCOUWCPQOAF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 6-cyclopentyl-6-[2-(1,3-thiazol-2-yl)ethyl]oxane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclopentyl-6-[2-(1,3-thiazol-2-yl)ethyl]oxane-2,4-dione?
The IUPAC name of 6-cyclopentyl-6-[2-(1,3-thiazol-2-yl)ethyl]oxane-2,4-dione (CID 16728680) is 6-cyclopentyl-6-[2-(1,3-thiazol-2-yl)ethyl]oxane-2,4-dione.
What is the SMILES notation for 6-cyclopentyl-6-[2-(1,3-thiazol-2-yl)ethyl]oxane-2,4-dione?
The canonical SMILES for 6-cyclopentyl-6-[2-(1,3-thiazol-2-yl)ethyl]oxane-2,4-dione is O=C1CC(=O)OC(CCc2nccs2)(C2CCCC2)C1.
What is the InChIKey of 6-cyclopentyl-6-[2-(1,3-thiazol-2-yl)ethyl]oxane-2,4-dione?
The InChIKey is VMVNCOUWCPQOAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO3S/c17-12-9-14(18)19-15(10-12,11-3-1-2-4-11)6-5-13-16-7-8-20-13/h7-8,11H,1-6,9-10H2.
What are the key properties of 6-cyclopentyl-6-[2-(1,3-thiazol-2-yl)ethyl]oxane-2,4-dione?
6-cyclopentyl-6-[2-(1,3-thiazol-2-yl)ethyl]oxane-2,4-dione has a molecular weight of 293.39 g/mol, XLogP of 2.91, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopentyl-6-[2-(1,3-thiazol-2-yl)ethyl]oxane-2,4-dione is sourced from PubChem (CID 16728680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).