About (5-fluoro-4,6-dimethylpyrrolo[2,3-b]pyridin-1-yl)phosphane
(5-fluoro-4,6-dimethylpyrrolo[2,3-b]pyridin-1-yl)phosphane (PubChem CID 167286817) has the molecular formula C9H10FN2P
and a molecular weight of 196.16 g/mol. Its IUPAC name is (5-fluoro-4,6-dimethylpyrrolo[2,3-b]pyridin-1-yl)phosphane.
Molecular Properties
| Compound Name | (5-fluoro-4,6-dimethylpyrrolo[2,3-b]pyridin-1-yl)phosphane |
| PubChem CID | 167286817 |
| Molecular Formula | C9H10FN2P |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | (5-fluoro-4,6-dimethylpyrrolo[2,3-b]pyridin-1-yl)phosphane |
| SMILES | Cc1nc2c(ccn2P)c(C)c1F |
| InChI | InChI=1S/C9H10FN2P/c1-5-7-3-4-12(13)9(7)11-6(2)8(5)10/h3-4H,13H2,1-2H3 |
| InChIKey | WGZOPCJEMLHWEB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (5-fluoro-4,6-dimethylpyrrolo[2,3-b]pyridin-1-yl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoro-4,6-dimethylpyrrolo[2,3-b]pyridin-1-yl)phosphane?
The IUPAC name of (5-fluoro-4,6-dimethylpyrrolo[2,3-b]pyridin-1-yl)phosphane (CID 167286817) is (5-fluoro-4,6-dimethylpyrrolo[2,3-b]pyridin-1-yl)phosphane.
What is the SMILES notation for (5-fluoro-4,6-dimethylpyrrolo[2,3-b]pyridin-1-yl)phosphane?
The canonical SMILES for (5-fluoro-4,6-dimethylpyrrolo[2,3-b]pyridin-1-yl)phosphane is Cc1nc2c(ccn2P)c(C)c1F.
What is the InChIKey of (5-fluoro-4,6-dimethylpyrrolo[2,3-b]pyridin-1-yl)phosphane?
The InChIKey is WGZOPCJEMLHWEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FN2P/c1-5-7-3-4-12(13)9(7)11-6(2)8(5)10/h3-4H,13H2,1-2H3.
What are the key properties of (5-fluoro-4,6-dimethylpyrrolo[2,3-b]pyridin-1-yl)phosphane?
(5-fluoro-4,6-dimethylpyrrolo[2,3-b]pyridin-1-yl)phosphane has a molecular weight of 196.16 g/mol, XLogP of 2.43, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoro-4,6-dimethylpyrrolo[2,3-b]pyridin-1-yl)phosphane is sourced from PubChem (CID 167286817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).