About 3-phenylimidazo[4,5-b]pyridine-5-carbonitrile
3-phenylimidazo[4,5-b]pyridine-5-carbonitrile (PubChem CID 167287119) has the molecular formula C13H8N4
and a molecular weight of 220.24 g/mol. Its IUPAC name is 3-phenylimidazo[4,5-b]pyridine-5-carbonitrile.
Molecular Properties
| Compound Name | 3-phenylimidazo[4,5-b]pyridine-5-carbonitrile |
| PubChem CID | 167287119 |
| Molecular Formula | C13H8N4 |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 3-phenylimidazo[4,5-b]pyridine-5-carbonitrile |
| SMILES | N#Cc1ccc2ncn(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C13H8N4/c14-8-10-6-7-12-13(16-10)17(9-15-12)11-4-2-1-3-5-11/h1-7,9H |
| InChIKey | SKMVWABKSAKRCT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-phenylimidazo[4,5-b]pyridine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylimidazo[4,5-b]pyridine-5-carbonitrile?
The IUPAC name of 3-phenylimidazo[4,5-b]pyridine-5-carbonitrile (CID 167287119) is 3-phenylimidazo[4,5-b]pyridine-5-carbonitrile.
What is the SMILES notation for 3-phenylimidazo[4,5-b]pyridine-5-carbonitrile?
The canonical SMILES for 3-phenylimidazo[4,5-b]pyridine-5-carbonitrile is N#Cc1ccc2ncn(-c3ccccc3)c2n1.
What is the InChIKey of 3-phenylimidazo[4,5-b]pyridine-5-carbonitrile?
The InChIKey is SKMVWABKSAKRCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N4/c14-8-10-6-7-12-13(16-10)17(9-15-12)11-4-2-1-3-5-11/h1-7,9H.
What are the key properties of 3-phenylimidazo[4,5-b]pyridine-5-carbonitrile?
3-phenylimidazo[4,5-b]pyridine-5-carbonitrile has a molecular weight of 220.24 g/mol, XLogP of 2.29, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylimidazo[4,5-b]pyridine-5-carbonitrile is sourced from PubChem (CID 167287119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).