C24H26N6O3 — CID 167287507
ethanimidoyl 13-methyl-2,19-dioxo-3,5,12,18-tetrazatetracyclo[18.3.1.04,12.06,11]tetracosa-1(23),4,6,8,10,20(24),21-heptaene-10-carboximidate (PubChem CID 167287507) has the molecular formula C24H26N6O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is ethanimidoyl 13-methyl-2,19-dioxo-3,5,12,18-tetrazatetracyclo[18.3.1.04,12.06,11]tetracosa-1(23),4,6,8,10,20(24),21-heptaene-10-carboximidate.
| Compound Name | ethanimidoyl 13-methyl-2,19-dioxo-3,5,12,18-tetrazatetracyclo[18.3.1.04,12.06,11]tetracosa-1(23),4,6,8,10,20(24),21-heptaene-10-carboximidate |
|---|---|
| PubChem CID | 167287507 |
| Molecular Formula | C24H26N6O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | ethanimidoyl 13-methyl-2,19-dioxo-3,5,12,18-tetrazatetracyclo[18.3.1.04,12.06,11]tetracosa-1(23),4,6,8,10,20(24),21-heptaene-10-carboximidate |
| SMILES | [H]/N=C(\O/C(C)=N/[H])c1cccc2nc3n(c12)C(C)CCCCNC(=O)c1cccc(c1)C(=O)N3 |
| InChI | InChI=1S/C24H26N6O3/c1-14-7-3-4-12-27-22(31)16-8-5-9-17(13-16)23(32)29-24-28-19-11-6-10-18(20(19)30(14)24)21(26)33-15(2)25/h5-6,8-11,13-14,25-26H,3-4,7,12H2,1-2H3,(H,27,31)(H,28,29,32)/b25-15+,26-21- |
| InChIKey | KZNVXLOLHBIGTD-CWJWPRAQSA-N |
| XLogP | 4.10 |
| TPSA | 132.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|