C18H25N3 — CID 167287524
N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-3-imino-N-methyl-2-methylidene-N'-[(Z)-prop-1-enyl]pent-4-enimidamide (PubChem CID 167287524) has the molecular formula C18H25N3 and a molecular weight of 283.42 g/mol. Its IUPAC name is N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-3-imino-N-methyl-2-methylidene-N'-[(Z)-prop-1-enyl]pent-4-enimidamide.
| Compound Name | N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-3-imino-N-methyl-2-methylidene-N'-[(Z)-prop-1-enyl]pent-4-enimidamide |
|---|---|
| PubChem CID | 167287524 |
| Molecular Formula | C18H25N3 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-3-imino-N-methyl-2-methylidene-N'-[(Z)-prop-1-enyl]pent-4-enimidamide |
| SMILES | [H]/N=C(\C=C)C(=C)/C(=N/C=C\C)N(C)CC(/C=C\C=C)=C/C |
| InChI | InChI=1S/C18H25N3/c1-7-11-12-16(9-3)14-21(6)18(20-13-8-2)15(5)17(19)10-4/h7-13,19H,1,4-5,14H2,2-3,6H3/b12-11-,13-8-,16-9+,19-17+,20-18- |
| InChIKey | XJOBNGVLOZZWEL-QVUNOXHWSA-N |
| XLogP | 4.30 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|