C7H4F12N2O7S3 — CID 167287680
3,3,3-trifluoro-N-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylsulfamoyl)propyl]sulfonylpropanamide (PubChem CID 167287680) has the molecular formula C7H4F12N2O7S3 and a molecular weight of 552.29 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylsulfamoyl)propyl]sulfonylpropanamide.
| Compound Name | 3,3,3-trifluoro-N-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylsulfamoyl)propyl]sulfonylpropanamide |
|---|---|
| PubChem CID | 167287680 |
| Molecular Formula | C7H4F12N2O7S3 |
| Molecular Weight | 552.29 g/mol |
| Exact Mass | 551.90 |
| IUPAC Name | 3,3,3-trifluoro-N-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylsulfamoyl)propyl]sulfonylpropanamide |
| SMILES | O=C(CC(F)(F)F)NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H4F12N2O7S3/c8-3(9,10)1-2(22)20-29(23,24)5(13,14)4(11,12)6(15,16)30(25,26)21-31(27,28)7(17,18)19/h21H,1H2,(H,20,22) |
| InChIKey | KQIKLNGQWBYPMT-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 143.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.29 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|