About N-[(3Z)-5-methylsulfanylhexa-1,3,5-trien-2-yl]methanimine
N-[(3Z)-5-methylsulfanylhexa-1,3,5-trien-2-yl]methanimine (PubChem CID 167288345) has the molecular formula C8H11NS
and a molecular weight of 153.25 g/mol. Its IUPAC name is N-[(3Z)-5-methylsulfanylhexa-1,3,5-trien-2-yl]methanimine.
Molecular Properties
| Compound Name | N-[(3Z)-5-methylsulfanylhexa-1,3,5-trien-2-yl]methanimine |
| PubChem CID | 167288345 |
| Molecular Formula | C8H11NS |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | N-[(3Z)-5-methylsulfanylhexa-1,3,5-trien-2-yl]methanimine |
| SMILES | C=NC(=C)/C=C/C(=C)SC |
| InChI | InChI=1S/C8H11NS/c1-7(9-3)5-6-8(2)10-4/h5-6H,1-3H2,4H3/b6-5- |
| InChIKey | HHZFWHJFPBRVTE-WAYWQWQTSA-N |
| XLogP | 2.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3Z)-5-methylsulfanylhexa-1,3,5-trien-2-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3Z)-5-methylsulfanylhexa-1,3,5-trien-2-yl]methanimine?
The IUPAC name of N-[(3Z)-5-methylsulfanylhexa-1,3,5-trien-2-yl]methanimine (CID 167288345) is N-[(3Z)-5-methylsulfanylhexa-1,3,5-trien-2-yl]methanimine.
What is the SMILES notation for N-[(3Z)-5-methylsulfanylhexa-1,3,5-trien-2-yl]methanimine?
The canonical SMILES for N-[(3Z)-5-methylsulfanylhexa-1,3,5-trien-2-yl]methanimine is C=NC(=C)/C=C/C(=C)SC.
What is the InChIKey of N-[(3Z)-5-methylsulfanylhexa-1,3,5-trien-2-yl]methanimine?
The InChIKey is HHZFWHJFPBRVTE-WAYWQWQTSA-N. The full InChI is InChI=1S/C8H11NS/c1-7(9-3)5-6-8(2)10-4/h5-6H,1-3H2,4H3/b6-5-.
What are the key properties of N-[(3Z)-5-methylsulfanylhexa-1,3,5-trien-2-yl]methanimine?
N-[(3Z)-5-methylsulfanylhexa-1,3,5-trien-2-yl]methanimine has a molecular weight of 153.25 g/mol, XLogP of 2.63, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3Z)-5-methylsulfanylhexa-1,3,5-trien-2-yl]methanimine is sourced from PubChem (CID 167288345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).