About 2-N-(2,3-dimethylbutan-2-ylsulfamoyl)propane-1,2-diamine
2-N-(2,3-dimethylbutan-2-ylsulfamoyl)propane-1,2-diamine (PubChem CID 167288359) has the molecular formula C9H23N3O2S
and a molecular weight of 237.37 g/mol. Its IUPAC name is 2-N-(2,3-dimethylbutan-2-ylsulfamoyl)propane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-(2,3-dimethylbutan-2-ylsulfamoyl)propane-1,2-diamine |
| PubChem CID | 167288359 |
| Molecular Formula | C9H23N3O2S |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 2-N-(2,3-dimethylbutan-2-ylsulfamoyl)propane-1,2-diamine |
| SMILES | CC(CN)NS(=O)(=O)NC(C)(C)C(C)C |
| InChI | InChI=1S/C9H23N3O2S/c1-7(2)9(4,5)12-15(13,14)11-8(3)6-10/h7-8,11-12H,6,10H2,1-5H3 |
| InChIKey | ZOGBPTQAGCHUGM-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N-(2,3-dimethylbutan-2-ylsulfamoyl)propane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(2,3-dimethylbutan-2-ylsulfamoyl)propane-1,2-diamine?
The IUPAC name of 2-N-(2,3-dimethylbutan-2-ylsulfamoyl)propane-1,2-diamine (CID 167288359) is 2-N-(2,3-dimethylbutan-2-ylsulfamoyl)propane-1,2-diamine.
What is the SMILES notation for 2-N-(2,3-dimethylbutan-2-ylsulfamoyl)propane-1,2-diamine?
The canonical SMILES for 2-N-(2,3-dimethylbutan-2-ylsulfamoyl)propane-1,2-diamine is CC(CN)NS(=O)(=O)NC(C)(C)C(C)C.
What is the InChIKey of 2-N-(2,3-dimethylbutan-2-ylsulfamoyl)propane-1,2-diamine?
The InChIKey is ZOGBPTQAGCHUGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H23N3O2S/c1-7(2)9(4,5)12-15(13,14)11-8(3)6-10/h7-8,11-12H,6,10H2,1-5H3.
What are the key properties of 2-N-(2,3-dimethylbutan-2-ylsulfamoyl)propane-1,2-diamine?
2-N-(2,3-dimethylbutan-2-ylsulfamoyl)propane-1,2-diamine has a molecular weight of 237.37 g/mol, XLogP of 0.19, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(2,3-dimethylbutan-2-ylsulfamoyl)propane-1,2-diamine is sourced from PubChem (CID 167288359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).