C27H55NS — CID 167288369
2,2,3,4-tetramethyl-N-(2,3,3-trimethyl-4-propyldodecan-2-yl)pentanethioamide (PubChem CID 167288369) has the molecular formula C27H55NS and a molecular weight of 425.81 g/mol. Its IUPAC name is 2,2,3,4-tetramethyl-N-(2,3,3-trimethyl-4-propyldodecan-2-yl)pentanethioamide.
| Compound Name | 2,2,3,4-tetramethyl-N-(2,3,3-trimethyl-4-propyldodecan-2-yl)pentanethioamide |
|---|---|
| PubChem CID | 167288369 |
| Molecular Formula | C27H55NS |
| Molecular Weight | 425.81 g/mol |
| Exact Mass | 425.41 |
| IUPAC Name | 2,2,3,4-tetramethyl-N-(2,3,3-trimethyl-4-propyldodecan-2-yl)pentanethioamide |
| SMILES | CCCCCCCCC(CCC)C(C)(C)C(C)(C)NC(=S)C(C)(C)C(C)C(C)C |
| InChI | InChI=1S/C27H55NS/c1-12-14-15-16-17-18-20-23(19-13-2)26(8,9)27(10,11)28-24(29)25(6,7)22(5)21(3)4/h21-23H,12-20H2,1-11H3,(H,28,29) |
| InChIKey | YDYCIJIPWGFDFM-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.81 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|