C58H68N2 — CID 167289260
3-(3,6-ditert-butylcarbazol-9-yl)-4-(7-methyltridecan-7-yl)-5,9-diphenylcarbazole (PubChem CID 167289260) has the molecular formula C58H68N2 and a molecular weight of 793.20 g/mol. Its IUPAC name is 3-(3,6-ditert-butylcarbazol-9-yl)-4-(7-methyltridecan-7-yl)-5,9-diphenylcarbazole.
| Compound Name | 3-(3,6-ditert-butylcarbazol-9-yl)-4-(7-methyltridecan-7-yl)-5,9-diphenylcarbazole |
|---|---|
| PubChem CID | 167289260 |
| Molecular Formula | C58H68N2 |
| Molecular Weight | 793.20 g/mol |
| Exact Mass | 792.54 |
| IUPAC Name | 3-(3,6-ditert-butylcarbazol-9-yl)-4-(7-methyltridecan-7-yl)-5,9-diphenylcarbazole |
| SMILES | CCCCCCC(C)(CCCCCC)c1c(-n2c3ccc(C(C)(C)C)cc3c3cc(C(C)(C)C)ccc32)ccc2c1c1c(-c3ccccc3)cccc1n2-c1ccccc1 |
| InChI | InChI=1S/C58H68N2/c1-10-12-14-22-37-58(9,38-23-15-13-11-2)55-52(60-48-33-31-42(56(3,4)5)39-46(48)47-40-43(57(6,7)8)32-34-49(47)60)36-35-51-54(55)53-45(41-25-18-16-19-26-41)29-24-30-50(53)59(51)44-27-20-17-21-28-44/h16-21,24-36,39-40H,10-15,22-23,37-38H2,1-9H3 |
| InChIKey | FYQMCJNXSICISH-UHFFFAOYSA-N |
| XLogP | 17.34 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.20 |
| LogP ≤ 5 | 17.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|