About (3Z)-2,2-ditert-butyl-3-ethylidene-5,8-dioxaspiro[3.4]octane
(3Z)-2,2-ditert-butyl-3-ethylidene-5,8-dioxaspiro[3.4]octane (PubChem CID 167289402) has the molecular formula C16H28O2
and a molecular weight of 252.40 g/mol. Its IUPAC name is (3Z)-2,2-ditert-butyl-3-ethylidene-5,8-dioxaspiro[3.4]octane.
Molecular Properties
| Compound Name | (3Z)-2,2-ditert-butyl-3-ethylidene-5,8-dioxaspiro[3.4]octane |
| PubChem CID | 167289402 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | (3Z)-2,2-ditert-butyl-3-ethylidene-5,8-dioxaspiro[3.4]octane |
| SMILES | C/C=C1\C2(CC1(C(C)(C)C)C(C)(C)C)OCCO2 |
| InChI | InChI=1S/C16H28O2/c1-8-12-15(13(2,3)4,14(5,6)7)11-16(12)17-9-10-18-16/h8H,9-11H2,1-7H3/b12-8- |
| InChIKey | HSZQWBPUCVRVHY-WQLSENKSSA-N |
| XLogP | 4.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-2,2-ditert-butyl-3-ethylidene-5,8-dioxaspiro[3.4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-2,2-ditert-butyl-3-ethylidene-5,8-dioxaspiro[3.4]octane?
The IUPAC name of (3Z)-2,2-ditert-butyl-3-ethylidene-5,8-dioxaspiro[3.4]octane (CID 167289402) is (3Z)-2,2-ditert-butyl-3-ethylidene-5,8-dioxaspiro[3.4]octane.
What is the SMILES notation for (3Z)-2,2-ditert-butyl-3-ethylidene-5,8-dioxaspiro[3.4]octane?
The canonical SMILES for (3Z)-2,2-ditert-butyl-3-ethylidene-5,8-dioxaspiro[3.4]octane is C/C=C1\C2(CC1(C(C)(C)C)C(C)(C)C)OCCO2.
What is the InChIKey of (3Z)-2,2-ditert-butyl-3-ethylidene-5,8-dioxaspiro[3.4]octane?
The InChIKey is HSZQWBPUCVRVHY-WQLSENKSSA-N. The full InChI is InChI=1S/C16H28O2/c1-8-12-15(13(2,3)4,14(5,6)7)11-16(12)17-9-10-18-16/h8H,9-11H2,1-7H3/b12-8-.
What are the key properties of (3Z)-2,2-ditert-butyl-3-ethylidene-5,8-dioxaspiro[3.4]octane?
(3Z)-2,2-ditert-butyl-3-ethylidene-5,8-dioxaspiro[3.4]octane has a molecular weight of 252.40 g/mol, XLogP of 4.16, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-2,2-ditert-butyl-3-ethylidene-5,8-dioxaspiro[3.4]octane is sourced from PubChem (CID 167289402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).