About (2,6-dimethylphenyl) 2-(2,6-diethylmorpholin-4-yl)acetate
(2,6-dimethylphenyl) 2-(2,6-diethylmorpholin-4-yl)acetate (PubChem CID 167289615) has the molecular formula C18H27NO3
and a molecular weight of 305.42 g/mol. Its IUPAC name is (2,6-dimethylphenyl) 2-(2,6-diethylmorpholin-4-yl)acetate.
Molecular Properties
| Compound Name | (2,6-dimethylphenyl) 2-(2,6-diethylmorpholin-4-yl)acetate |
| PubChem CID | 167289615 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | (2,6-dimethylphenyl) 2-(2,6-diethylmorpholin-4-yl)acetate |
| SMILES | CCC1CN(CC(=O)Oc2c(C)cccc2C)CC(CC)O1 |
| InChI | InChI=1S/C18H27NO3/c1-5-15-10-19(11-16(6-2)21-15)12-17(20)22-18-13(3)8-7-9-14(18)4/h7-9,15-16H,5-6,10-12H2,1-4H3 |
| InChIKey | YNUQKWVEVJCNCS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,6-dimethylphenyl) 2-(2,6-diethylmorpholin-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dimethylphenyl) 2-(2,6-diethylmorpholin-4-yl)acetate?
The IUPAC name of (2,6-dimethylphenyl) 2-(2,6-diethylmorpholin-4-yl)acetate (CID 167289615) is (2,6-dimethylphenyl) 2-(2,6-diethylmorpholin-4-yl)acetate.
What is the SMILES notation for (2,6-dimethylphenyl) 2-(2,6-diethylmorpholin-4-yl)acetate?
The canonical SMILES for (2,6-dimethylphenyl) 2-(2,6-diethylmorpholin-4-yl)acetate is CCC1CN(CC(=O)Oc2c(C)cccc2C)CC(CC)O1.
What is the InChIKey of (2,6-dimethylphenyl) 2-(2,6-diethylmorpholin-4-yl)acetate?
The InChIKey is YNUQKWVEVJCNCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27NO3/c1-5-15-10-19(11-16(6-2)21-15)12-17(20)22-18-13(3)8-7-9-14(18)4/h7-9,15-16H,5-6,10-12H2,1-4H3.
What are the key properties of (2,6-dimethylphenyl) 2-(2,6-diethylmorpholin-4-yl)acetate?
(2,6-dimethylphenyl) 2-(2,6-diethylmorpholin-4-yl)acetate has a molecular weight of 305.42 g/mol, XLogP of 3.10, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dimethylphenyl) 2-(2,6-diethylmorpholin-4-yl)acetate is sourced from PubChem (CID 167289615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).