C27H47N4O6+ — CID 167290042
(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 3-[3-[3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-3-oxopropyl]imidazol-3-ium-1-yl]propanoate (PubChem CID 167290042) has the molecular formula C27H47N4O6+ and a molecular weight of 523.70 g/mol. Its IUPAC name is (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 3-[3-[3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-3-oxopropyl]imidazol-3-ium-1-yl]propanoate.
| Compound Name | (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 3-[3-[3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-3-oxopropyl]imidazol-3-ium-1-yl]propanoate |
|---|---|
| PubChem CID | 167290042 |
| Molecular Formula | C27H47N4O6+ |
| Molecular Weight | 523.70 g/mol |
| Exact Mass | 523.35 |
| IUPAC Name | (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 3-[3-[3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-3-oxopropyl]imidazol-3-ium-1-yl]propanoate |
| SMILES | CC1(C)CC(OC(=O)CCn2cc[n+](CCC(=O)OC3CC(C)(C)N(O)C(C)(C)C3)c2)CC(C)(C)N1O |
| InChI | InChI=1S/C27H47N4O6/c1-24(2)15-20(16-25(3,4)30(24)34)36-22(32)9-11-28-13-14-29(19-28)12-10-23(33)37-21-17-26(5,6)31(35)27(7,8)18-21/h13-14,19-21,34-35H,9-12,15-18H2,1-8H3/q+1 |
| InChIKey | YFEQEUFCJZKUSU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.70 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|