About 1-(7-ethyl-9,9-dimethylfluoren-2-yl)fluoren-9-one
1-(7-ethyl-9,9-dimethylfluoren-2-yl)fluoren-9-one (PubChem CID 167290199) has the molecular formula C30H24O
and a molecular weight of 400.52 g/mol. Its IUPAC name is 1-(7-ethyl-9,9-dimethylfluoren-2-yl)fluoren-9-one.
Molecular Properties
| Compound Name | 1-(7-ethyl-9,9-dimethylfluoren-2-yl)fluoren-9-one |
| PubChem CID | 167290199 |
| Molecular Formula | C30H24O |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 1-(7-ethyl-9,9-dimethylfluoren-2-yl)fluoren-9-one |
| SMILES | CCc1ccc2c(c1)C(C)(C)c1cc(-c3cccc4c3C(=O)c3ccccc3-4)ccc1-2 |
| InChI | InChI=1S/C30H24O/c1-4-18-12-14-22-23-15-13-19(17-27(23)30(2,3)26(22)16-18)20-10-7-11-24-21-8-5-6-9-25(21)29(31)28(20)24/h5-17H,4H2,1-3H3 |
| InChIKey | ZTPMXRLVXLYSCG-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(7-ethyl-9,9-dimethylfluoren-2-yl)fluoren-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-ethyl-9,9-dimethylfluoren-2-yl)fluoren-9-one?
The IUPAC name of 1-(7-ethyl-9,9-dimethylfluoren-2-yl)fluoren-9-one (CID 167290199) is 1-(7-ethyl-9,9-dimethylfluoren-2-yl)fluoren-9-one.
What is the SMILES notation for 1-(7-ethyl-9,9-dimethylfluoren-2-yl)fluoren-9-one?
The canonical SMILES for 1-(7-ethyl-9,9-dimethylfluoren-2-yl)fluoren-9-one is CCc1ccc2c(c1)C(C)(C)c1cc(-c3cccc4c3C(=O)c3ccccc3-4)ccc1-2.
What is the InChIKey of 1-(7-ethyl-9,9-dimethylfluoren-2-yl)fluoren-9-one?
The InChIKey is ZTPMXRLVXLYSCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H24O/c1-4-18-12-14-22-23-15-13-19(17-27(23)30(2,3)26(22)16-18)20-10-7-11-24-21-8-5-6-9-25(21)29(31)28(20)24/h5-17H,4H2,1-3H3.
What are the key properties of 1-(7-ethyl-9,9-dimethylfluoren-2-yl)fluoren-9-one?
1-(7-ethyl-9,9-dimethylfluoren-2-yl)fluoren-9-one has a molecular weight of 400.52 g/mol, XLogP of 7.43, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-ethyl-9,9-dimethylfluoren-2-yl)fluoren-9-one is sourced from PubChem (CID 167290199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).