C35H31FN4O4S — CID 16729049
benzyl (2R)-2-[[4-[3-benzyl-2-(3-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]phenyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 16729049) has the molecular formula C35H31FN4O4S and a molecular weight of 622.72 g/mol. Its IUPAC name is benzyl (2R)-2-[[4-[3-benzyl-2-(3-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]phenyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R)-2-[[4-[3-benzyl-2-(3-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]phenyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 16729049 |
| Molecular Formula | C35H31FN4O4S |
| Molecular Weight | 622.72 g/mol |
| Exact Mass | 622.21 |
| IUPAC Name | benzyl (2R)-2-[[4-[3-benzyl-2-(3-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]phenyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | O=C(Nc1ccc(C2S/C(=N\c3cccc(F)c3)N(Cc3ccccc3)C2=O)cc1)[C@H]1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C35H31FN4O4S/c36-27-13-7-14-29(21-27)38-34-40(22-24-9-3-1-4-10-24)33(42)31(45-34)26-16-18-28(19-17-26)37-32(41)30-15-8-20-39(30)35(43)44-23-25-11-5-2-6-12-25/h1-7,9-14,16-19,21,30-31H,8,15,20,22-23H2,(H,37,41)/b38-34-/t30-,31?/m1/s1 |
| InChIKey | OJVMFIDGPPEPFP-OAJKOCFCSA-N |
| XLogP | 7.07 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.72 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|