C28H27Cl2FN6O3 — CID 167290996
6-[2-amino-5-[(S)-amino-(3,5-dichloro-2-fluoro-4-pyridinyl)methoxy]benzenecarboximidoyl]-1'-ethylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-8-carbonitrile (PubChem CID 167290996) has the molecular formula C28H27Cl2FN6O3 and a molecular weight of 585.47 g/mol. Its IUPAC name is 6-[2-amino-5-[(S)-amino-(3,5-dichloro-2-fluoro-4-pyridinyl)methoxy]benzenecarboximidoyl]-1'-ethylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-8-carbonitrile.
| Compound Name | 6-[2-amino-5-[(S)-amino-(3,5-dichloro-2-fluoro-4-pyridinyl)methoxy]benzenecarboximidoyl]-1'-ethylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-8-carbonitrile |
|---|---|
| PubChem CID | 167290996 |
| Molecular Formula | C28H27Cl2FN6O3 |
| Molecular Weight | 585.47 g/mol |
| Exact Mass | 584.15 |
| IUPAC Name | 6-[2-amino-5-[(S)-amino-(3,5-dichloro-2-fluoro-4-pyridinyl)methoxy]benzenecarboximidoyl]-1'-ethylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-8-carbonitrile |
| SMILES | [H]/N=C(\c1cc(C#N)c2c(c1)COC1(CCN(CC)CC1)O2)c1cc(O[C@H](N)c2c(Cl)cnc(F)c2Cl)ccc1N |
| InChI | InChI=1S/C28H27Cl2FN6O3/c1-2-37-7-5-28(6-8-37)38-14-17-10-15(9-16(12-32)25(17)40-28)24(34)19-11-18(3-4-21(19)33)39-27(35)22-20(29)13-36-26(31)23(22)30/h3-4,9-11,13,27,34H,2,5-8,14,33,35H2,1H3/b34-24+/t27-/m0/s1 |
| InChIKey | VGDDHMVAOVLXGC-SJVWPHNPSA-N |
| XLogP | 5.15 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|