C17H16ClN3O2S — CID 167291023
8-(4-chlorophenyl)-11-methylsulfonyl-1,6,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene (PubChem CID 167291023) has the molecular formula C17H16ClN3O2S and a molecular weight of 361.85 g/mol. Its IUPAC name is 8-(4-chlorophenyl)-11-methylsulfonyl-1,6,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene.
| Compound Name | 8-(4-chlorophenyl)-11-methylsulfonyl-1,6,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene |
|---|---|
| PubChem CID | 167291023 |
| Molecular Formula | C17H16ClN3O2S |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 8-(4-chlorophenyl)-11-methylsulfonyl-1,6,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene |
| SMILES | CS(=O)(=O)N1CCn2c(c(-c3ccc(Cl)cc3)c3ncccc32)C1 |
| InChI | InChI=1S/C17H16ClN3O2S/c1-24(22,23)20-9-10-21-14-3-2-8-19-17(14)16(15(21)11-20)12-4-6-13(18)7-5-12/h2-8H,9-11H2,1H3 |
| InChIKey | XNNVKQHYUXPDON-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |