C15H27FN2 — CID 167291286
(3S,4R)-3-fluoro-1-methyl-N-[(3Z)-7-methylocta-1,3-dien-2-yl]piperidin-4-amine (PubChem CID 167291286) has the molecular formula C15H27FN2 and a molecular weight of 254.39 g/mol. Its IUPAC name is (3S,4R)-3-fluoro-1-methyl-N-[(3Z)-7-methylocta-1,3-dien-2-yl]piperidin-4-amine.
| Compound Name | (3S,4R)-3-fluoro-1-methyl-N-[(3Z)-7-methylocta-1,3-dien-2-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 167291286 |
| Molecular Formula | C15H27FN2 |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | (3S,4R)-3-fluoro-1-methyl-N-[(3Z)-7-methylocta-1,3-dien-2-yl]piperidin-4-amine |
| SMILES | C=C(/C=C\CCC(C)C)N[C@@H]1CCN(C)C[C@@H]1F |
| InChI | InChI=1S/C15H27FN2/c1-12(2)7-5-6-8-13(3)17-15-9-10-18(4)11-14(15)16/h6,8,12,14-15,17H,3,5,7,9-11H2,1-2,4H3/b8-6-/t14-,15+/m0/s1 |
| InChIKey | RYDQTQSFZQCSSZ-NEFCLYRVSA-N |
| XLogP | 3.12 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|