About 1-tert-butyl-3-(2,2,2-trifluoroethoxy)azetidine
1-tert-butyl-3-(2,2,2-trifluoroethoxy)azetidine (PubChem CID 167291896) has the molecular formula C9H16F3NO
and a molecular weight of 211.23 g/mol. Its IUPAC name is 1-tert-butyl-3-(2,2,2-trifluoroethoxy)azetidine.
Molecular Properties
| Compound Name | 1-tert-butyl-3-(2,2,2-trifluoroethoxy)azetidine |
| PubChem CID | 167291896 |
| Molecular Formula | C9H16F3NO |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 1-tert-butyl-3-(2,2,2-trifluoroethoxy)azetidine |
| SMILES | CC(C)(C)N1CC(OCC(F)(F)F)C1 |
| InChI | InChI=1S/C9H16F3NO/c1-8(2,3)13-4-7(5-13)14-6-9(10,11)12/h7H,4-6H2,1-3H3 |
| InChIKey | OEEJSLZNGFEQGR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butyl-3-(2,2,2-trifluoroethoxy)azetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3-(2,2,2-trifluoroethoxy)azetidine?
The IUPAC name of 1-tert-butyl-3-(2,2,2-trifluoroethoxy)azetidine (CID 167291896) is 1-tert-butyl-3-(2,2,2-trifluoroethoxy)azetidine.
What is the SMILES notation for 1-tert-butyl-3-(2,2,2-trifluoroethoxy)azetidine?
The canonical SMILES for 1-tert-butyl-3-(2,2,2-trifluoroethoxy)azetidine is CC(C)(C)N1CC(OCC(F)(F)F)C1.
What is the InChIKey of 1-tert-butyl-3-(2,2,2-trifluoroethoxy)azetidine?
The InChIKey is OEEJSLZNGFEQGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO/c1-8(2,3)13-4-7(5-13)14-6-9(10,11)12/h7H,4-6H2,1-3H3.
What are the key properties of 1-tert-butyl-3-(2,2,2-trifluoroethoxy)azetidine?
1-tert-butyl-3-(2,2,2-trifluoroethoxy)azetidine has a molecular weight of 211.23 g/mol, XLogP of 2.05, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3-(2,2,2-trifluoroethoxy)azetidine is sourced from PubChem (CID 167291896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).