C16H21IN4O — CID 167292066
1-[4-(8-iodo-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 167292066) has the molecular formula C16H21IN4O and a molecular weight of 412.28 g/mol. Its IUPAC name is 1-[4-(8-iodo-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-(8-iodo-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167292066 |
| Molecular Formula | C16H21IN4O |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 1-[4-(8-iodo-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2ncnc3c2CCCC(I)C3)CC1 |
| InChI | InChI=1S/C16H21IN4O/c1-2-15(22)20-6-8-21(9-7-20)16-13-5-3-4-12(17)10-14(13)18-11-19-16/h2,11-12H,1,3-10H2 |
| InChIKey | IRZSPJRLFGCPPP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|