C11H18N2O4 — CID 167292199
3-[(4aS,7aS)-5-oxo-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-2,2-dimethylpropanoic acid (PubChem CID 167292199) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is 3-[(4aS,7aS)-5-oxo-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[(4aS,7aS)-5-oxo-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 167292199 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 3-[(4aS,7aS)-5-oxo-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(CN1C[C@@H]2OCCN[C@@H]2C1=O)C(=O)O |
| InChI | InChI=1S/C11H18N2O4/c1-11(2,10(15)16)6-13-5-7-8(9(13)14)12-3-4-17-7/h7-8,12H,3-6H2,1-2H3,(H,15,16)/t7-,8-/m0/s1 |
| InChIKey | NXBKLBGNNJZAFT-YUMQZZPRSA-N |
| XLogP | -0.70 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |