About N-ethyl-5-(4-fluoropiperidin-1-yl)-N,2,5-trimethylhexan-2-amine
N-ethyl-5-(4-fluoropiperidin-1-yl)-N,2,5-trimethylhexan-2-amine (PubChem CID 167292295) has the molecular formula C16H33FN2
and a molecular weight of 272.45 g/mol. Its IUPAC name is N-ethyl-5-(4-fluoropiperidin-1-yl)-N,2,5-trimethylhexan-2-amine.
Molecular Properties
| Compound Name | N-ethyl-5-(4-fluoropiperidin-1-yl)-N,2,5-trimethylhexan-2-amine |
| PubChem CID | 167292295 |
| Molecular Formula | C16H33FN2 |
| Molecular Weight | 272.45 g/mol |
| Exact Mass | 272.26 |
| IUPAC Name | N-ethyl-5-(4-fluoropiperidin-1-yl)-N,2,5-trimethylhexan-2-amine |
| SMILES | CCN(C)C(C)(C)CCC(C)(C)N1CCC(F)CC1 |
| InChI | InChI=1S/C16H33FN2/c1-7-18(6)15(2,3)10-11-16(4,5)19-12-8-14(17)9-13-19/h14H,7-13H2,1-6H3 |
| InChIKey | SBFRGOIUNRMTOP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-5-(4-fluoropiperidin-1-yl)-N,2,5-trimethylhexan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-5-(4-fluoropiperidin-1-yl)-N,2,5-trimethylhexan-2-amine?
The IUPAC name of N-ethyl-5-(4-fluoropiperidin-1-yl)-N,2,5-trimethylhexan-2-amine (CID 167292295) is N-ethyl-5-(4-fluoropiperidin-1-yl)-N,2,5-trimethylhexan-2-amine.
What is the SMILES notation for N-ethyl-5-(4-fluoropiperidin-1-yl)-N,2,5-trimethylhexan-2-amine?
The canonical SMILES for N-ethyl-5-(4-fluoropiperidin-1-yl)-N,2,5-trimethylhexan-2-amine is CCN(C)C(C)(C)CCC(C)(C)N1CCC(F)CC1.
What is the InChIKey of N-ethyl-5-(4-fluoropiperidin-1-yl)-N,2,5-trimethylhexan-2-amine?
The InChIKey is SBFRGOIUNRMTOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33FN2/c1-7-18(6)15(2,3)10-11-16(4,5)19-12-8-14(17)9-13-19/h14H,7-13H2,1-6H3.
What are the key properties of N-ethyl-5-(4-fluoropiperidin-1-yl)-N,2,5-trimethylhexan-2-amine?
N-ethyl-5-(4-fluoropiperidin-1-yl)-N,2,5-trimethylhexan-2-amine has a molecular weight of 272.45 g/mol, XLogP of 3.71, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-5-(4-fluoropiperidin-1-yl)-N,2,5-trimethylhexan-2-amine is sourced from PubChem (CID 167292295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).