C31H51N — CID 167292327
N-[5-[(3Z)-4,6-dimethylhepta-1,3,5-trien-2-yl]-4-(3-methylbutan-2-yl)-2-prop-1-en-2-ylcyclohexen-1-yl]-3-methylheptan-2-imine (PubChem CID 167292327) has the molecular formula C31H51N and a molecular weight of 437.76 g/mol. Its IUPAC name is N-[5-[(3Z)-4,6-dimethylhepta-1,3,5-trien-2-yl]-4-(3-methylbutan-2-yl)-2-prop-1-en-2-ylcyclohexen-1-yl]-3-methylheptan-2-imine.
| Compound Name | N-[5-[(3Z)-4,6-dimethylhepta-1,3,5-trien-2-yl]-4-(3-methylbutan-2-yl)-2-prop-1-en-2-ylcyclohexen-1-yl]-3-methylheptan-2-imine |
|---|---|
| PubChem CID | 167292327 |
| Molecular Formula | C31H51N |
| Molecular Weight | 437.76 g/mol |
| Exact Mass | 437.40 |
| IUPAC Name | N-[5-[(3Z)-4,6-dimethylhepta-1,3,5-trien-2-yl]-4-(3-methylbutan-2-yl)-2-prop-1-en-2-ylcyclohexen-1-yl]-3-methylheptan-2-imine |
| SMILES | C=C(C)C1=C(/N=C(\C)C(C)CCCC)CC(C(=C)/C=C(/C)C=C(C)C)C(C(C)C(C)C)C1 |
| InChI | InChI=1S/C31H51N/c1-13-14-15-24(9)27(12)32-31-19-29(25(10)17-23(8)16-20(2)3)30(26(11)21(4)5)18-28(31)22(6)7/h16-17,21,24,26,29-30H,6,10,13-15,18-19H2,1-5,7-9,11-12H3/b23-17-,32-27+ |
| InChIKey | GPVKLMPTFVSIPT-UFXAEPQMSA-N |
| XLogP | 9.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.76 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|