C8H13NO3 — CID 167292720
5-(2-aminoethyl)cyclohexa-1,5-diene-1,2,3-triol (PubChem CID 167292720) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is 5-(2-aminoethyl)cyclohexa-1,5-diene-1,2,3-triol.
| Compound Name | 5-(2-aminoethyl)cyclohexa-1,5-diene-1,2,3-triol |
|---|---|
| PubChem CID | 167292720 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 5-(2-aminoethyl)cyclohexa-1,5-diene-1,2,3-triol |
| SMILES | NCCC1=CC(O)=C(O)C(O)C1 |
| InChI | InChI=1S/C8H13NO3/c9-2-1-5-3-6(10)8(12)7(11)4-5/h3,7,10-12H,1-2,4,9H2 |
| InChIKey | OJNBRSLXDQSFJB-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |