C17H16O6 — CID 167292761
5,13-dioxahexacyclo[8.6.2.12,8.01,9.03,7.011,15]nonadecane-4,6,12,14-tetrone (PubChem CID 167292761) has the molecular formula C17H16O6 and a molecular weight of 316.31 g/mol. Its IUPAC name is 5,13-dioxahexacyclo[8.6.2.12,8.01,9.03,7.011,15]nonadecane-4,6,12,14-tetrone.
| Compound Name | 5,13-dioxahexacyclo[8.6.2.12,8.01,9.03,7.011,15]nonadecane-4,6,12,14-tetrone |
|---|---|
| PubChem CID | 167292761 |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 5,13-dioxahexacyclo[8.6.2.12,8.01,9.03,7.011,15]nonadecane-4,6,12,14-tetrone |
| SMILES | O=C1OC(=O)C2C1CC13CCC2C1C1CC3C2C(=O)OC(=O)C12 |
| InChI | InChI=1S/C17H16O6/c18-13-7-4-17-2-1-5(9(7)14(19)22-13)12(17)6-3-8(17)11-10(6)15(20)23-16(11)21/h5-12H,1-4H2 |
| InChIKey | MQYYYSGNYYSWLD-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|