C19H20N8O4S2 — CID 16729279
N-[3-[(2-acetamido-1,3-thiazol-4-yl)methyl]-5-[2-(2-acetylhydrazinyl)-2-oxoethyl]sulfanyl-1,2,4-triazol-4-yl]benzamide (PubChem CID 16729279) has the molecular formula C19H20N8O4S2 and a molecular weight of 488.56 g/mol. Its IUPAC name is N-[3-[(2-acetamido-1,3-thiazol-4-yl)methyl]-5-[2-(2-acetylhydrazinyl)-2-oxoethyl]sulfanyl-1,2,4-triazol-4-yl]benzamide.
| Compound Name | N-[3-[(2-acetamido-1,3-thiazol-4-yl)methyl]-5-[2-(2-acetylhydrazinyl)-2-oxoethyl]sulfanyl-1,2,4-triazol-4-yl]benzamide |
|---|---|
| PubChem CID | 16729279 |
| Molecular Formula | C19H20N8O4S2 |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | N-[3-[(2-acetamido-1,3-thiazol-4-yl)methyl]-5-[2-(2-acetylhydrazinyl)-2-oxoethyl]sulfanyl-1,2,4-triazol-4-yl]benzamide |
| SMILES | CC(=O)NNC(=O)CSc1nnc(Cc2csc(NC(C)=O)n2)n1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H20N8O4S2/c1-11(28)20-18-21-14(9-32-18)8-15-23-25-19(33-10-16(30)24-22-12(2)29)27(15)26-17(31)13-6-4-3-5-7-13/h3-7,9H,8,10H2,1-2H3,(H,22,29)(H,24,30)(H,26,31)(H,20,21,28) |
| InChIKey | AXWXMUIURGSJKE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 160.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|