About N-[(7-ethyl-3-bicyclo[3.3.1]non-2-enyl)methyl]-N'-(1H-pyrrolo[3,2-b]pyridin-3-yl)oxamide
N-[(7-ethyl-3-bicyclo[3.3.1]non-2-enyl)methyl]-N'-(1H-pyrrolo[3,2-b]pyridin-3-yl)oxamide (PubChem CID 167292974) has the molecular formula C21H26N4O2
and a molecular weight of 366.47 g/mol. Its IUPAC name is N-[(7-ethyl-3-bicyclo[3.3.1]non-2-enyl)methyl]-N'-(1H-pyrrolo[3,2-b]pyridin-3-yl)oxamide.
Molecular Properties
| Compound Name | N-[(7-ethyl-3-bicyclo[3.3.1]non-2-enyl)methyl]-N'-(1H-pyrrolo[3,2-b]pyridin-3-yl)oxamide |
| PubChem CID | 167292974 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | N-[(7-ethyl-3-bicyclo[3.3.1]non-2-enyl)methyl]-N'-(1H-pyrrolo[3,2-b]pyridin-3-yl)oxamide |
| SMILES | CCC1CC2C=C(CNC(=O)C(=O)Nc3c[nH]c4cccnc34)CC(C2)C1 |
| InChI | InChI=1S/C21H26N4O2/c1-2-13-6-14-8-15(7-13)10-16(9-14)11-24-20(26)21(27)25-18-12-23-17-4-3-5-22-19(17)18/h3-5,9,12-15,23H,2,6-8,10-11H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | ACTXLMHJOJYGEB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(7-ethyl-3-bicyclo[3.3.1]non-2-enyl)methyl]-N'-(1H-pyrrolo[3,2-b]pyridin-3-yl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(7-ethyl-3-bicyclo[3.3.1]non-2-enyl)methyl]-N'-(1H-pyrrolo[3,2-b]pyridin-3-yl)oxamide?
The IUPAC name of N-[(7-ethyl-3-bicyclo[3.3.1]non-2-enyl)methyl]-N'-(1H-pyrrolo[3,2-b]pyridin-3-yl)oxamide (CID 167292974) is N-[(7-ethyl-3-bicyclo[3.3.1]non-2-enyl)methyl]-N'-(1H-pyrrolo[3,2-b]pyridin-3-yl)oxamide.
What is the SMILES notation for N-[(7-ethyl-3-bicyclo[3.3.1]non-2-enyl)methyl]-N'-(1H-pyrrolo[3,2-b]pyridin-3-yl)oxamide?
The canonical SMILES for N-[(7-ethyl-3-bicyclo[3.3.1]non-2-enyl)methyl]-N'-(1H-pyrrolo[3,2-b]pyridin-3-yl)oxamide is CCC1CC2C=C(CNC(=O)C(=O)Nc3c[nH]c4cccnc34)CC(C2)C1.
What is the InChIKey of N-[(7-ethyl-3-bicyclo[3.3.1]non-2-enyl)methyl]-N'-(1H-pyrrolo[3,2-b]pyridin-3-yl)oxamide?
The InChIKey is ACTXLMHJOJYGEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N4O2/c1-2-13-6-14-8-15(7-13)10-16(9-14)11-24-20(26)21(27)25-18-12-23-17-4-3-5-22-19(17)18/h3-5,9,12-15,23H,2,6-8,10-11H2,1H3,(H,24,26)(H,25,27).
What are the key properties of N-[(7-ethyl-3-bicyclo[3.3.1]non-2-enyl)methyl]-N'-(1H-pyrrolo[3,2-b]pyridin-3-yl)oxamide?
N-[(7-ethyl-3-bicyclo[3.3.1]non-2-enyl)methyl]-N'-(1H-pyrrolo[3,2-b]pyridin-3-yl)oxamide has a molecular weight of 366.47 g/mol, XLogP of 3.39, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(7-ethyl-3-bicyclo[3.3.1]non-2-enyl)methyl]-N'-(1H-pyrrolo[3,2-b]pyridin-3-yl)oxamide is sourced from PubChem (CID 167292974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).