C16H18F3N5O — CID 167293010
(4Z)-4-[(3Z,5E)-1-amino-7-nitroso-5-(trifluoromethyl)octa-3,5,7-trienylidene]-N'-methyl-1H-pyridine-3-carboximidamide (PubChem CID 167293010) has the molecular formula C16H18F3N5O and a molecular weight of 353.35 g/mol. Its IUPAC name is (4Z)-4-[(3Z,5E)-1-amino-7-nitroso-5-(trifluoromethyl)octa-3,5,7-trienylidene]-N'-methyl-1H-pyridine-3-carboximidamide.
| Compound Name | (4Z)-4-[(3Z,5E)-1-amino-7-nitroso-5-(trifluoromethyl)octa-3,5,7-trienylidene]-N'-methyl-1H-pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 167293010 |
| Molecular Formula | C16H18F3N5O |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | (4Z)-4-[(3Z,5E)-1-amino-7-nitroso-5-(trifluoromethyl)octa-3,5,7-trienylidene]-N'-methyl-1H-pyridine-3-carboximidamide |
| SMILES | C=C(/C=C(\C=C/C/C(N)=C1\C=CNC=C1/C(N)=N/C)C(F)(F)F)N=O |
| InChI | InChI=1S/C16H18F3N5O/c1-10(24-25)8-11(16(17,18)19)4-3-5-14(20)12-6-7-23-9-13(12)15(21)22-2/h3-4,6-9,23H,1,5,20H2,2H3,(H2,21,22)/b4-3-,11-8+,14-12- |
| InChIKey | NHRRLCMZWOUEJT-HIFBINKVSA-N |
| XLogP | 2.90 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|