About 4-[1-(4-tert-butyl-1,3-benzothiazol-7-yl)-2-methylpropan-2-yl]-1,3-benzoxazole
4-[1-(4-tert-butyl-1,3-benzothiazol-7-yl)-2-methylpropan-2-yl]-1,3-benzoxazole (PubChem CID 167294356) has the molecular formula C22H24N2OS
and a molecular weight of 364.51 g/mol. Its IUPAC name is 4-[1-(4-tert-butyl-1,3-benzothiazol-7-yl)-2-methylpropan-2-yl]-1,3-benzoxazole.
Molecular Properties
| Compound Name | 4-[1-(4-tert-butyl-1,3-benzothiazol-7-yl)-2-methylpropan-2-yl]-1,3-benzoxazole |
| PubChem CID | 167294356 |
| Molecular Formula | C22H24N2OS |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 4-[1-(4-tert-butyl-1,3-benzothiazol-7-yl)-2-methylpropan-2-yl]-1,3-benzoxazole |
| SMILES | CC(C)(C)c1ccc(CC(C)(C)c2cccc3ocnc23)c2scnc12 |
| InChI | InChI=1S/C22H24N2OS/c1-21(2,3)15-10-9-14(20-19(15)24-13-26-20)11-22(4,5)16-7-6-8-17-18(16)23-12-25-17/h6-10,12-13H,11H2,1-5H3 |
| InChIKey | IJHDDCJYVCQDKP-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[1-(4-tert-butyl-1,3-benzothiazol-7-yl)-2-methylpropan-2-yl]-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(4-tert-butyl-1,3-benzothiazol-7-yl)-2-methylpropan-2-yl]-1,3-benzoxazole?
The IUPAC name of 4-[1-(4-tert-butyl-1,3-benzothiazol-7-yl)-2-methylpropan-2-yl]-1,3-benzoxazole (CID 167294356) is 4-[1-(4-tert-butyl-1,3-benzothiazol-7-yl)-2-methylpropan-2-yl]-1,3-benzoxazole.
What is the SMILES notation for 4-[1-(4-tert-butyl-1,3-benzothiazol-7-yl)-2-methylpropan-2-yl]-1,3-benzoxazole?
The canonical SMILES for 4-[1-(4-tert-butyl-1,3-benzothiazol-7-yl)-2-methylpropan-2-yl]-1,3-benzoxazole is CC(C)(C)c1ccc(CC(C)(C)c2cccc3ocnc23)c2scnc12.
What is the InChIKey of 4-[1-(4-tert-butyl-1,3-benzothiazol-7-yl)-2-methylpropan-2-yl]-1,3-benzoxazole?
The InChIKey is IJHDDCJYVCQDKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2OS/c1-21(2,3)15-10-9-14(20-19(15)24-13-26-20)11-22(4,5)16-7-6-8-17-18(16)23-12-25-17/h6-10,12-13H,11H2,1-5H3.
What are the key properties of 4-[1-(4-tert-butyl-1,3-benzothiazol-7-yl)-2-methylpropan-2-yl]-1,3-benzoxazole?
4-[1-(4-tert-butyl-1,3-benzothiazol-7-yl)-2-methylpropan-2-yl]-1,3-benzoxazole has a molecular weight of 364.51 g/mol, XLogP of 6.26, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(4-tert-butyl-1,3-benzothiazol-7-yl)-2-methylpropan-2-yl]-1,3-benzoxazole is sourced from PubChem (CID 167294356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).