About 2-amino-4-phenyl-1,3-thiazole-5-carboxamide
2-amino-4-phenyl-1,3-thiazole-5-carboxamide (PubChem CID 16729436) has the molecular formula C10H9N3OS
and a molecular weight of 219.27 g/mol. Its IUPAC name is 2-amino-4-phenyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-amino-4-phenyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 16729436 |
| Molecular Formula | C10H9N3OS |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 2-amino-4-phenyl-1,3-thiazole-5-carboxamide |
| SMILES | NC(=O)c1sc(N)nc1-c1ccccc1 |
| InChI | InChI=1S/C10H9N3OS/c11-9(14)8-7(13-10(12)15-8)6-4-2-1-3-5-6/h1-5H,(H2,11,14)(H2,12,13) |
| InChIKey | CCEJBFWILLLYKV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-4-phenyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-phenyl-1,3-thiazole-5-carboxamide?
The IUPAC name of 2-amino-4-phenyl-1,3-thiazole-5-carboxamide (CID 16729436) is 2-amino-4-phenyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 2-amino-4-phenyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for 2-amino-4-phenyl-1,3-thiazole-5-carboxamide is NC(=O)c1sc(N)nc1-c1ccccc1.
What is the InChIKey of 2-amino-4-phenyl-1,3-thiazole-5-carboxamide?
The InChIKey is CCEJBFWILLLYKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3OS/c11-9(14)8-7(13-10(12)15-8)6-4-2-1-3-5-6/h1-5H,(H2,11,14)(H2,12,13).
What are the key properties of 2-amino-4-phenyl-1,3-thiazole-5-carboxamide?
2-amino-4-phenyl-1,3-thiazole-5-carboxamide has a molecular weight of 219.27 g/mol, XLogP of 1.49, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-phenyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 16729436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).