C23H21FN8O2 — CID 16729457
1-[(2R)-4-(benzenecarboximidoyl)-2-methylpiperazin-1-yl]-2-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione (PubChem CID 16729457) has the molecular formula C23H21FN8O2 and a molecular weight of 460.47 g/mol. Its IUPAC name is 1-[(2R)-4-(benzenecarboximidoyl)-2-methylpiperazin-1-yl]-2-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione.
| Compound Name | 1-[(2R)-4-(benzenecarboximidoyl)-2-methylpiperazin-1-yl]-2-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 16729457 |
| Molecular Formula | C23H21FN8O2 |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 1-[(2R)-4-(benzenecarboximidoyl)-2-methylpiperazin-1-yl]-2-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione |
| SMILES | [H]/N=C(\c1ccccc1)N1CCN(C(=O)C(=O)c2c[nH]c3c(-n4ccnn4)ncc(F)c23)[C@H](C)C1 |
| InChI | InChI=1S/C23H21FN8O2/c1-14-13-30(21(25)15-5-3-2-4-6-15)9-10-31(14)23(34)20(33)16-11-26-19-18(16)17(24)12-27-22(19)32-8-7-28-29-32/h2-8,11-12,14,25-26H,9-10,13H2,1H3/b25-21+/t14-/m1/s1 |
| InChIKey | QPRACCBMFLWKJV-RJGFPMBASA-N |
| XLogP | 2.02 |
| TPSA | 123.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|