C26H27FN8O4 — CID 16729465
1-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-[N-[2-(2-hydroxyethoxy)ethyl]-C-phenylcarbonimidoyl]piperazin-1-yl]ethane-1,2-dione (PubChem CID 16729465) has the molecular formula C26H27FN8O4 and a molecular weight of 534.55 g/mol. Its IUPAC name is 1-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-[N-[2-(2-hydroxyethoxy)ethyl]-C-phenylcarbonimidoyl]piperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-[N-[2-(2-hydroxyethoxy)ethyl]-C-phenylcarbonimidoyl]piperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 16729465 |
| Molecular Formula | C26H27FN8O4 |
| Molecular Weight | 534.55 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | 1-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-[N-[2-(2-hydroxyethoxy)ethyl]-C-phenylcarbonimidoyl]piperazin-1-yl]ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCN(/C(=N/CCOCCO)c2ccccc2)CC1)c1c[nH]c2c(-n3ccnn3)ncc(F)c12 |
| InChI | InChI=1S/C26H27FN8O4/c27-20-17-30-25(35-8-6-31-32-35)22-21(20)19(16-29-22)23(37)26(38)34-11-9-33(10-12-34)24(18-4-2-1-3-5-18)28-7-14-39-15-13-36/h1-6,8,16-17,29,36H,7,9-15H2/b28-24+ |
| InChIKey | FXFXKYAZMFJNNB-ZZIIXHQDSA-N |
| XLogP | 1.07 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.55 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|