About (4E,5E)-5-ethylidene-4-propylidene-1,3-thiazolidin-2-one
(4E,5E)-5-ethylidene-4-propylidene-1,3-thiazolidin-2-one (PubChem CID 167294879) has the molecular formula C8H11NOS
and a molecular weight of 169.25 g/mol. Its IUPAC name is (4E,5E)-5-ethylidene-4-propylidene-1,3-thiazolidin-2-one.
Molecular Properties
| Compound Name | (4E,5E)-5-ethylidene-4-propylidene-1,3-thiazolidin-2-one |
| PubChem CID | 167294879 |
| Molecular Formula | C8H11NOS |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | (4E,5E)-5-ethylidene-4-propylidene-1,3-thiazolidin-2-one |
| SMILES | C/C=c1/sc(=O)[nH]/c1=C/CC |
| InChI | InChI=1S/C8H11NOS/c1-3-5-6-7(4-2)11-8(10)9-6/h4-5H,3H2,1-2H3,(H,9,10)/b6-5+,7-4+ |
| InChIKey | RCJNCLIPLGUJSV-HVUXDCMCSA-N |
| XLogP | 0.43 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4E,5E)-5-ethylidene-4-propylidene-1,3-thiazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,5E)-5-ethylidene-4-propylidene-1,3-thiazolidin-2-one?
The IUPAC name of (4E,5E)-5-ethylidene-4-propylidene-1,3-thiazolidin-2-one (CID 167294879) is (4E,5E)-5-ethylidene-4-propylidene-1,3-thiazolidin-2-one.
What is the SMILES notation for (4E,5E)-5-ethylidene-4-propylidene-1,3-thiazolidin-2-one?
The canonical SMILES for (4E,5E)-5-ethylidene-4-propylidene-1,3-thiazolidin-2-one is C/C=c1/sc(=O)[nH]/c1=C/CC.
What is the InChIKey of (4E,5E)-5-ethylidene-4-propylidene-1,3-thiazolidin-2-one?
The InChIKey is RCJNCLIPLGUJSV-HVUXDCMCSA-N. The full InChI is InChI=1S/C8H11NOS/c1-3-5-6-7(4-2)11-8(10)9-6/h4-5H,3H2,1-2H3,(H,9,10)/b6-5+,7-4+.
What are the key properties of (4E,5E)-5-ethylidene-4-propylidene-1,3-thiazolidin-2-one?
(4E,5E)-5-ethylidene-4-propylidene-1,3-thiazolidin-2-one has a molecular weight of 169.25 g/mol, XLogP of 0.43, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,5E)-5-ethylidene-4-propylidene-1,3-thiazolidin-2-one is sourced from PubChem (CID 167294879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).