C11H18FNO — CID 167294893
(2R,8S)-2-fluoro-8-[(1R)-1-methoxyprop-2-enyl]-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 167294893) has the molecular formula C11H18FNO and a molecular weight of 199.27 g/mol. Its IUPAC name is (2R,8S)-2-fluoro-8-[(1R)-1-methoxyprop-2-enyl]-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | (2R,8S)-2-fluoro-8-[(1R)-1-methoxyprop-2-enyl]-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 167294893 |
| Molecular Formula | C11H18FNO |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | (2R,8S)-2-fluoro-8-[(1R)-1-methoxyprop-2-enyl]-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | C=C[C@@H](OC)[C@@]12CCCN1C[C@H](F)C2 |
| InChI | InChI=1S/C11H18FNO/c1-3-10(14-2)11-5-4-6-13(11)8-9(12)7-11/h3,9-10H,1,4-8H2,2H3/t9-,10-,11+/m1/s1 |
| InChIKey | ZXJDIUQMNQXCIB-MXWKQRLJSA-N |
| XLogP | 1.76 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|