C10H11NS — CID 167294933
(2E,3Z)-2,3-di(ethylidene)-6H-thieno[2,3-b]pyrrole (PubChem CID 167294933) has the molecular formula C10H11NS and a molecular weight of 177.27 g/mol. Its IUPAC name is (2E,3Z)-2,3-di(ethylidene)-6H-thieno[2,3-b]pyrrole.
| Compound Name | (2E,3Z)-2,3-di(ethylidene)-6H-thieno[2,3-b]pyrrole |
|---|---|
| PubChem CID | 167294933 |
| Molecular Formula | C10H11NS |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | (2E,3Z)-2,3-di(ethylidene)-6H-thieno[2,3-b]pyrrole |
| SMILES | C/C=c1\c(=C/C)sc2[nH]ccc12 |
| InChI | InChI=1S/C10H11NS/c1-3-7-8-5-6-11-10(8)12-9(7)4-2/h3-6,11H,1-2H3/b7-3-,9-4+ |
| InChIKey | ZNGREOVUZRYSSA-CITSBAIRSA-N |
| XLogP | 1.83 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |